C27H24ClFN4O2S — CID 59380407
2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethylamino]ethanol (PubChem CID 59380407) has the molecular formula C27H24ClFN4O2S and a molecular weight of 523.03 g/mol. Its IUPAC name is 2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethylamino]ethanol.
| Compound Name | 2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethylamino]ethanol |
|---|---|
| PubChem CID | 59380407 |
| Molecular Formula | C27H24ClFN4O2S |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 2-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethylamino]ethanol |
| SMILES | OCCNCCc1ccc2c(c1)sc1ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12 |
| InChI | InChI=1S/C27H24ClFN4O2S/c28-22-14-20(5-7-23(22)35-15-18-2-1-3-19(29)12-18)33-26-25-21-6-4-17(8-9-30-10-11-34)13-24(21)36-27(25)32-16-31-26/h1-7,12-14,16,30,34H,8-11,15H2,(H,31,32,33) |
| InChIKey | JFCCJCARTWGFRA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|