C28H31ClFN5OS — CID 142993781
N'-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethyl]-N-methylethane-1,2-diamine (PubChem CID 142993781) has the molecular formula C28H31ClFN5OS and a molecular weight of 540.11 g/mol. Its IUPAC name is N'-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142993781 |
| Molecular Formula | C28H31ClFN5OS |
| Molecular Weight | 540.11 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N'-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCC1CCc2c(sc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C28H31ClFN5OS/c1-31-11-12-32-10-9-18-5-7-22-25(14-18)37-28-26(22)27(33-17-34-28)35-21-6-8-24(23(29)15-21)36-16-19-3-2-4-20(30)13-19/h2-4,6,8,13,15,17-18,31-32H,5,7,9-12,14,16H2,1H3,(H,33,34,35) |
| InChIKey | MVJIMBLLFGEXNY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.11 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|