C27H21ClFN5O2S — CID 58346579
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[[(2S)-oxiran-2-yl]methyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine (PubChem CID 58346579) has the molecular formula C27H21ClFN5O2S and a molecular weight of 534.02 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[[(2S)-oxiran-2-yl]methyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[[(2S)-oxiran-2-yl]methyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine |
|---|---|
| PubChem CID | 58346579 |
| Molecular Formula | C27H21ClFN5O2S |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[[(2S)-oxiran-2-yl]methyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4sc5c(c34)CCc3c-5cnn3C[C@H]3CO3)cc2Cl)c1 |
| InChI | InChI=1S/C27H21ClFN5O2S/c28-21-9-17(4-7-23(21)36-12-15-2-1-3-16(29)8-15)33-26-24-19-5-6-22-20(10-32-34(22)11-18-13-35-18)25(19)37-27(24)31-14-30-26/h1-4,7-10,14,18H,5-6,11-13H2,(H,30,31,33)/t18-/m0/s1 |
| InChIKey | KYBONTUSVCWJFT-SFHVURJKSA-N |
| XLogP | 6.17 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|