C29H28ClFN6O2S — CID 58346696
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[2-(2-methoxyethylamino)ethyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine (PubChem CID 58346696) has the molecular formula C29H28ClFN6O2S and a molecular weight of 579.10 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[2-(2-methoxyethylamino)ethyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[2-(2-methoxyethylamino)ethyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine |
|---|---|
| PubChem CID | 58346696 |
| Molecular Formula | C29H28ClFN6O2S |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-5-[2-(2-methoxyethylamino)ethyl]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-amine |
| SMILES | COCCNCCn1ncc2c1CCc1c-2sc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12 |
| InChI | InChI=1S/C29H28ClFN6O2S/c1-38-12-10-32-9-11-37-24-7-6-21-26-28(33-17-34-29(26)40-27(21)22(24)15-35-37)36-20-5-8-25(23(30)14-20)39-16-18-3-2-4-19(31)13-18/h2-5,8,13-15,17,32H,6-7,9-12,16H2,1H3,(H,33,34,36) |
| InChIKey | YNSNGIQDAVCXHZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|