C18H26F3N7O — CID 123577809
2-[[4-[hydrazinyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)methyl]cyclohexyl]methylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 123577809) has the molecular formula C18H26F3N7O and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[[4-[hydrazinyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)methyl]cyclohexyl]methylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[4-[hydrazinyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)methyl]cyclohexyl]methylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 123577809 |
| Molecular Formula | C18H26F3N7O |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-[[4-[hydrazinyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)methyl]cyclohexyl]methylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | NNC(c1ncnc2[nH]ccc12)C1CCC(CNCC(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N7O/c19-18(20,21)9-25-14(29)8-23-7-11-1-3-12(4-2-11)15(28-22)16-13-5-6-24-17(13)27-10-26-16/h5-6,10-12,15,23,28H,1-4,7-9,22H2,(H,25,29)(H,24,26,27) |
| InChIKey | UUCVZRLOIDGMHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|