C20H24F2N6O — CID 144531667
3,3-difluoro-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]hex-5-enamide (PubChem CID 144531667) has the molecular formula C20H24F2N6O and a molecular weight of 402.45 g/mol. Its IUPAC name is 3,3-difluoro-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]hex-5-enamide.
| Compound Name | 3,3-difluoro-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]hex-5-enamide |
|---|---|
| PubChem CID | 144531667 |
| Molecular Formula | C20H24F2N6O |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3,3-difluoro-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]hex-5-enamide |
| SMILES | C=CCC(F)(F)CC(=O)NCC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1 |
| InChI | InChI=1S/C20H24F2N6O/c1-2-8-20(21,22)10-16(29)24-11-13-3-5-14(6-4-13)17-18-15-7-9-23-19(15)25-12-28(18)27-26-17/h2,7,9,12-14,23H,1,3-6,8,10-11H2,(H,24,29) |
| InChIKey | LGPXVVIQMPACTF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|