C16H19N5OS — CID 136980239
S-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl] ethanethioate (PubChem CID 136980239) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is S-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl] ethanethioate.
| Compound Name | S-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 136980239 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | S-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1 |
| InChI | InChI=1S/C16H19N5OS/c1-10(22)23-8-11-2-4-12(5-3-11)14-15-13-6-7-17-16(13)18-9-21(15)20-19-14/h6-7,9,11-12,17H,2-5,8H2,1H3 |
| InChIKey | FNTDWLPCWWDDJQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|