C21H23ClN6 — CID 136980505
N-[2-(4-chlorophenyl)ethyl]-4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexan-1-amine (PubChem CID 136980505) has the molecular formula C21H23ClN6 and a molecular weight of 394.91 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexan-1-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 136980505 |
| Molecular Formula | C21H23ClN6 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexan-1-amine |
| SMILES | Clc1ccc(CCNC2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)cc1 |
| InChI | InChI=1S/C21H23ClN6/c22-16-5-1-14(2-6-16)9-11-23-17-7-3-15(4-8-17)19-20-18-10-12-24-21(18)25-13-28(20)27-26-19/h1-2,5-6,10,12-13,15,17,23-24H,3-4,7-9,11H2 |
| InChIKey | ZPAJIUBPKZGWEN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |