C26H29N7 — CID 136980335
1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 136980335) has the molecular formula C26H29N7 and a molecular weight of 439.57 g/mol. Its IUPAC name is 1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 136980335 |
| Molecular Formula | C26H29N7 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(CC2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)CC1 |
| InChI | InChI=1S/C26H29N7/c27-17-26(21-4-2-1-3-5-21)11-14-32(15-12-26)16-19-6-8-20(9-7-19)23-24-22-10-13-28-25(22)29-18-33(24)31-30-23/h1-5,10,13,18-20,28H,6-9,11-12,14-16H2 |
| InChIKey | HRWCHYZAAGLVNN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |