C20H19N7 — CID 136980226
3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 136980226) has the molecular formula C20H19N7 and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 136980226 |
| Molecular Formula | C20H19N7 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)c1 |
| InChI | InChI=1S/C20H19N7/c21-11-14-2-1-3-15(10-14)12-26-8-5-16(6-9-26)18-19-17-4-7-22-20(17)23-13-27(19)25-24-18/h1-4,7,10,13,16,22H,5-6,8-9,12H2 |
| InChIKey | VDJRBBPYNWAREB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |