C20H23N7 — CID 137158040
(3S)-1-[1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethenyl]pyrrolidine-3-carbonitrile (PubChem CID 137158040) has the molecular formula C20H23N7 and a molecular weight of 361.45 g/mol. Its IUPAC name is (3S)-1-[1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethenyl]pyrrolidine-3-carbonitrile.
| Compound Name | (3S)-1-[1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethenyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 137158040 |
| Molecular Formula | C20H23N7 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (3S)-1-[1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethenyl]pyrrolidine-3-carbonitrile |
| SMILES | C=C(C1CCC(c2nnn3cnc4[nH]ccc4c23)CC1)N1CC[C@H](C#N)C1 |
| InChI | InChI=1S/C20H23N7/c1-13(26-9-7-14(10-21)11-26)15-2-4-16(5-3-15)18-19-17-6-8-22-20(17)23-12-27(19)25-24-18/h6,8,12,14-16,22H,1-5,7,9,11H2/t14-,15?,16?/m1/s1 |
| InChIKey | FFJZEZRGLWMUAA-QQFBHYJXSA-N |
| XLogP | 3.24 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |