C14H17N5S — CID 136980241
[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methanethiol (PubChem CID 136980241) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is [4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methanethiol.
| Compound Name | [4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methanethiol |
|---|---|
| PubChem CID | 136980241 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methanethiol |
| SMILES | SCC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1 |
| InChI | InChI=1S/C14H17N5S/c20-7-9-1-3-10(4-2-9)12-13-11-5-6-15-14(11)16-8-19(13)18-17-12/h5-6,8-10,15,20H,1-4,7H2 |
| InChIKey | ACRMSFLLAJABLP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|