C16H23N7 — CID 137069115
1-N'-methyl-2-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethane-1,1-diamine (PubChem CID 137069115) has the molecular formula C16H23N7 and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-N'-methyl-2-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethane-1,1-diamine.
| Compound Name | 1-N'-methyl-2-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 137069115 |
| Molecular Formula | C16H23N7 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-N'-methyl-2-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]ethane-1,1-diamine |
| SMILES | CNC(N)CC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1 |
| InChI | InChI=1S/C16H23N7/c1-18-13(17)8-10-2-4-11(5-3-10)14-15-12-6-7-19-16(12)20-9-23(15)22-21-14/h6-7,9-11,13,18-19H,2-5,8,17H2,1H3 |
| InChIKey | VTFXJJWDSHSUGT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|