C22H26N6O — CID 136980322
(1S)-2-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methylamino]-1-phenylethanol (PubChem CID 136980322) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is (1S)-2-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methylamino]-1-phenylethanol.
| Compound Name | (1S)-2-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 136980322 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (1S)-2-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methylamino]-1-phenylethanol |
| SMILES | O[C@H](CNCC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H26N6O/c29-19(16-4-2-1-3-5-16)13-23-12-15-6-8-17(9-7-15)20-21-18-10-11-24-22(18)25-14-28(21)27-26-20/h1-5,10-11,14-15,17,19,23-24,29H,6-9,12-13H2/t15?,17?,19-/m1/s1 |
| InChIKey | FYGIJAJABTZJIG-GXOAENINSA-N |
| XLogP | 3.20 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |