C20H29N7 — CID 136980374
N-ethyl-N-methyl-1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]azetidin-3-amine (PubChem CID 136980374) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-ethyl-N-methyl-1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]azetidin-3-amine.
| Compound Name | N-ethyl-N-methyl-1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]azetidin-3-amine |
|---|---|
| PubChem CID | 136980374 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N-ethyl-N-methyl-1-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]azetidin-3-amine |
| SMILES | CCN(C)C1CN(CC2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)C1 |
| InChI | InChI=1S/C20H29N7/c1-3-25(2)16-11-26(12-16)10-14-4-6-15(7-5-14)18-19-17-8-9-21-20(17)22-13-27(19)24-23-18/h8-9,13-16,21H,3-7,10-12H2,1-2H3 |
| InChIKey | HXKUQMNJEYIBQI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |