C20H18FN7 — CID 136980482
3-fluoro-4-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]benzonitrile (PubChem CID 136980482) has the molecular formula C20H18FN7 and a molecular weight of 375.41 g/mol. Its IUPAC name is 3-fluoro-4-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]benzonitrile.
| Compound Name | 3-fluoro-4-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 136980482 |
| Molecular Formula | C20H18FN7 |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-fluoro-4-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]benzonitrile |
| SMILES | N#Cc1ccc(NC2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)c(F)c1 |
| InChI | InChI=1S/C20H18FN7/c21-16-9-12(10-22)1-6-17(16)25-14-4-2-13(3-5-14)18-19-15-7-8-23-20(15)24-11-28(19)27-26-18/h1,6-9,11,13-14,23,25H,2-5H2 |
| InChIKey | GTUQBUKJNCVDRI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |