C10H14N2 — CID 123579495
1,5,7-trimethyl-7aH-pyrrolo[2,3-b]pyridine (PubChem CID 123579495) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,5,7-trimethyl-7aH-pyrrolo[2,3-b]pyridine.
| Compound Name | 1,5,7-trimethyl-7aH-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123579495 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,5,7-trimethyl-7aH-pyrrolo[2,3-b]pyridine |
| SMILES | CC1=CN(C)C2C(=C1)C=CN2C |
| InChI | InChI=1S/C10H14N2/c1-8-6-9-4-5-11(2)10(9)12(3)7-8/h4-7,10H,1-3H3 |
| InChIKey | XEZWPWJZHPLLRW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |