About 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene
1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene (PubChem CID 123614469) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene.
Analyze 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene?
The IUPAC name of 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene (CID 123614469) is 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene.
What is the SMILES notation for 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene?
The canonical SMILES for 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene is C1=CN2C=CN3CC=CC(=C1)C23.
What is the InChIKey of 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene?
The InChIKey is GAKFKRIEDFVYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-3-9-4-2-6-12-8-7-11(5-1)10(9)12/h1-5,7-8,10H,6H2.
What are the key properties of 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene?
1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene has a molecular weight of 158.20 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazatricyclo[6.3.1.04,12]dodeca-2,5,7,9-tetraene is sourced from PubChem (CID 123614469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).