C12H9FIrN2-2 — CID 58517630
4-fluoro-2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;iridium (PubChem CID 58517630) has the molecular formula C12H9FIrN2-2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-fluoro-2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;iridium.
| Compound Name | 4-fluoro-2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;iridium |
|---|---|
| PubChem CID | 58517630 |
| Molecular Formula | C12H9FIrN2-2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-fluoro-2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;iridium |
| SMILES | CN1C=C2C(F)=Cc3ccc[c-]c3N2[CH-]1.[Ir] |
| InChI | InChI=1S/C12H9FN2.Ir/c1-14-7-12-10(13)6-9-4-2-3-5-11(9)15(12)8-14;/h2-4,6-8H,1H3;/q-2; |
| InChIKey | MILAMQXUUOFUPX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|