C15H16IrN2-2 — CID 58517699
iridium;2-methyl-3-propan-2-yl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide (PubChem CID 58517699) has the molecular formula C15H16IrN2-2 and a molecular weight of 416.52 g/mol. Its IUPAC name is iridium;2-methyl-3-propan-2-yl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide.
| Compound Name | iridium;2-methyl-3-propan-2-yl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide |
|---|---|
| PubChem CID | 58517699 |
| Molecular Formula | C15H16IrN2-2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | iridium;2-methyl-3-propan-2-yl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide |
| SMILES | CC(C)C1=C2C=Cc3ccc[c-]c3N2[CH-]N1C.[Ir] |
| InChI | InChI=1S/C15H16N2.Ir/c1-11(2)15-14-9-8-12-6-4-5-7-13(12)17(14)10-16(15)3;/h4-6,8-11H,1-3H3;/q-2; |
| InChIKey | NCPAGMZJYNCZRS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|