C14H14IrN2-2 — CID 58517932
iridium;2-propyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide (PubChem CID 58517932) has the molecular formula C14H14IrN2-2 and a molecular weight of 402.50 g/mol. Its IUPAC name is iridium;2-propyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide.
| Compound Name | iridium;2-propyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide |
|---|---|
| PubChem CID | 58517932 |
| Molecular Formula | C14H14IrN2-2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | iridium;2-propyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide |
| SMILES | CCCN1C=C2C=Cc3ccc[c-]c3N2[CH-]1.[Ir] |
| InChI | InChI=1S/C14H14N2.Ir/c1-2-9-15-10-13-8-7-12-5-3-4-6-14(12)16(13)11-15;/h3-5,7-8,10-11H,2,9H2,1H3;/q-2; |
| InChIKey | CYWRVWUKOJNJOL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|