C12H10N2Pt — CID 58517990
2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;platinum(2+) (PubChem CID 58517990) has the molecular formula C12H10N2Pt and a molecular weight of 377.30 g/mol. Its IUPAC name is 2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;platinum(2+).
| Compound Name | 2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;platinum(2+) |
|---|---|
| PubChem CID | 58517990 |
| Molecular Formula | C12H10N2Pt |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-methyl-1,9-dihydroimidazo[1,5-a]quinoline-1,9-diide;platinum(2+) |
| SMILES | CN1C=C2C=Cc3ccc[c-]c3N2[CH-]1.[Pt+2] |
| InChI | InChI=1S/C12H10N2.Pt/c1-13-8-11-7-6-10-4-2-3-5-12(10)14(11)9-13;/h2-4,6-9H,1H3;/q-2;+2 |
| InChIKey | XMNPGJLKVRYGPL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|