C27H25N3O4 — CID 123580017
5-[2-[4-(aminomethoxymethyl)phenyl]furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 123580017) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 5-[2-[4-(aminomethoxymethyl)phenyl]furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[2-[4-(aminomethoxymethyl)phenyl]furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 123580017 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 5-[2-[4-(aminomethoxymethyl)phenyl]furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc3cc(-c4ccc(COCN)cc4)oc23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C27H25N3O4/c28-15-21-13-20(5-6-25(21)33-22-8-11-31-12-9-22)23-7-10-30-24-14-26(34-27(23)24)19-3-1-18(2-4-19)16-32-17-29/h1-7,10,13-14,22H,8-9,11-12,16-17,29H2 |
| InChIKey | KZHPOVDMHRPSBS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|