C26H21N3O5 — CID 145224036
5-[2-(5-formyl-3-methoxy-2-pyridinyl)furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 145224036) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is 5-[2-(5-formyl-3-methoxy-2-pyridinyl)furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[2-(5-formyl-3-methoxy-2-pyridinyl)furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 145224036 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 5-[2-(5-formyl-3-methoxy-2-pyridinyl)furo[3,2-b]pyridin-7-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | COc1cc(C=O)cnc1-c1cc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)c2o1 |
| InChI | InChI=1S/C26H21N3O5/c1-31-23-10-16(15-30)14-29-25(23)24-12-21-26(34-24)20(4-7-28-21)17-2-3-22(18(11-17)13-27)33-19-5-8-32-9-6-19/h2-4,7,10-12,14-15,19H,5-6,8-9H2,1H3 |
| InChIKey | KPFLJRXXTPALNK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 107.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|