About 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine
5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine (PubChem CID 123580161) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine.
Molecular Properties
| Compound Name | 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine |
| PubChem CID | 123580161 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine |
| SMILES | [H]/N=C1\C=CCC(S(=C)(=C)CC)=CC1 |
| InChI | InChI=1S/C11H17NS/c1-4-13(2,3)11-7-5-6-10(12)8-9-11/h5-6,9,12H,2-4,7-8H2,1H3/b12-10+ |
| InChIKey | VYJGNSSFWMIHJD-ZRDIBKRKSA-N |
| XLogP | 2.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine?
The IUPAC name of 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine (CID 123580161) is 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine.
What is the SMILES notation for 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine?
The canonical SMILES for 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine is [H]/N=C1\C=CCC(S(=C)(=C)CC)=CC1.
What is the InChIKey of 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine?
The InChIKey is VYJGNSSFWMIHJD-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H17NS/c1-4-13(2,3)11-7-5-6-10(12)8-9-11/h5-6,9,12H,2-4,7-8H2,1H3/b12-10+.
What are the key properties of 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine?
5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine has a molecular weight of 195.33 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl(dimethylidene)-λ6-sulfanyl]cyclohepta-2,5-dien-1-imine is sourced from PubChem (CID 123580161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).