C8H13NS — CID 91374063
(3E)-3-ethylsulfanylhexa-3,5-dien-2-imine (PubChem CID 91374063) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is (3E)-3-ethylsulfanylhexa-3,5-dien-2-imine.
| Compound Name | (3E)-3-ethylsulfanylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 91374063 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (3E)-3-ethylsulfanylhexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(=C\C=C)SCC |
| InChI | InChI=1S/C8H13NS/c1-4-6-8(7(3)9)10-5-2/h4,6,9H,1,5H2,2-3H3/b8-6+,9-7+ |
| InChIKey | JOLNDAFDEBEWKR-CDJQDVQCSA-N |
| XLogP | 2.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|