C11H10NS+ — CID 20502085
(4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 20502085) has the molecular formula C11H10NS+ and a molecular weight of 188.28 g/mol. Its IUPAC name is (4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | (4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 20502085 |
| Molecular Formula | C11H10NS+ |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | [NH2+]=C1C=CC(=C2C=CC=CS2)C=C1 |
| InChI | InChI=1S/C11H9NS/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h1-8,12H/p+1/b11-9-,12-10? |
| InChIKey | NRJGMNNOWCEODK-ONNZKKIYSA-O |
| XLogP | 1.38 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|