C8H9NS — CID 89282869
(6Z)-6-(methylsulfanylmethylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 89282869) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is (6Z)-6-(methylsulfanylmethylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-6-(methylsulfanylmethylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 89282869 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | (6Z)-6-(methylsulfanylmethylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C\C1=C\SC |
| InChI | InChI=1S/C8H9NS/c1-10-6-7-4-2-3-5-8(7)9/h2-6,9H,1H3/b7-6-,9-8+ |
| InChIKey | WSQWVIJWGNYGIE-NMMTYZSQSA-N |
| XLogP | 2.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|