C10H13NS — CID 142431506
4-methylsulfanyl-5-prop-1-en-2-ylcyclohexa-2,4-dien-1-imine (PubChem CID 142431506) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 4-methylsulfanyl-5-prop-1-en-2-ylcyclohexa-2,4-dien-1-imine.
| Compound Name | 4-methylsulfanyl-5-prop-1-en-2-ylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142431506 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 4-methylsulfanyl-5-prop-1-en-2-ylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(SC)=C(C(=C)C)C1 |
| InChI | InChI=1S/C10H13NS/c1-7(2)9-6-8(11)4-5-10(9)12-3/h4-5,11H,1,6H2,2-3H3/b11-8+ |
| InChIKey | PLIPBRSDSCAPKI-DHZHZOJOSA-N |
| XLogP | 3.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|