C12H16N2S — CID 123670132
(3Z)-5-[(3Z)-5-iminohexa-1,3-dien-2-yl]sulfanylhexa-3,5-dien-2-imine (PubChem CID 123670132) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is (3Z)-5-[(3Z)-5-iminohexa-1,3-dien-2-yl]sulfanylhexa-3,5-dien-2-imine.
| Compound Name | (3Z)-5-[(3Z)-5-iminohexa-1,3-dien-2-yl]sulfanylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123670132 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (3Z)-5-[(3Z)-5-iminohexa-1,3-dien-2-yl]sulfanylhexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(=C)SC(=C)/C=C\C(C)=N\[H] |
| InChI | InChI=1S/C12H16N2S/c1-9(13)5-7-11(3)15-12(4)8-6-10(2)14/h5-8,13-14H,3-4H2,1-2H3/b7-5-,8-6-,13-9+,14-10+ |
| InChIKey | ICGHWVAFZJPHLP-HRFZYNDSSA-N |
| XLogP | 3.94 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|