C21H15F3N8O2 — CID 123581396
5-amino-3-(trifluoromethyl)pyridine-2-carbonitrile;2-isocyano-3-methyl-5-nitropyridine;2-isocyano-3-methylpyridine (PubChem CID 123581396) has the molecular formula C21H15F3N8O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 5-amino-3-(trifluoromethyl)pyridine-2-carbonitrile;2-isocyano-3-methyl-5-nitropyridine;2-isocyano-3-methylpyridine.
| Compound Name | 5-amino-3-(trifluoromethyl)pyridine-2-carbonitrile;2-isocyano-3-methyl-5-nitropyridine;2-isocyano-3-methylpyridine |
|---|---|
| PubChem CID | 123581396 |
| Molecular Formula | C21H15F3N8O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 5-amino-3-(trifluoromethyl)pyridine-2-carbonitrile;2-isocyano-3-methyl-5-nitropyridine;2-isocyano-3-methylpyridine |
| SMILES | N#Cc1ncc(N)cc1C(F)(F)F.[C-]#[N+]c1ncc([N+](=O)[O-])cc1C.[C-]#[N+]c1ncccc1C |
| InChI | InChI=1S/C7H4F3N3.C7H5N3O2.C7H6N2/c8-7(9,10)5-1-4(12)3-13-6(5)2-11;1-5-3-6(10(11)12)4-9-7(5)8-2;1-6-4-3-5-9-7(6)8-2/h1,3H,12H2;3-4H,1H3;3-5H,1H3 |
| InChIKey | WYKADQPJGOWAPE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|