C28H28N9O3S+ — CID 123581545
N-[2-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]pyrimidin-5-yl]benzamide (PubChem CID 123581545) has the molecular formula C28H28N9O3S+ and a molecular weight of 570.66 g/mol. Its IUPAC name is N-[2-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]pyrimidin-5-yl]benzamide.
| Compound Name | N-[2-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 123581545 |
| Molecular Formula | C28H28N9O3S+ |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | N-[2-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]pyrimidin-5-yl]benzamide |
| SMILES | COc1cc2[nH]c3nc[nH+]c(N4CCN(C(=S)Nc5ncc(NC(=O)c6ccccc6)cn5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C28H27N9O3S/c1-39-21-12-19-20(13-22(21)40-2)34-24-23(19)25(32-16-31-24)36-8-10-37(11-9-36)28(41)35-27-29-14-18(15-30-27)33-26(38)17-6-4-3-5-7-17/h3-7,12-16H,8-11H2,1-2H3,(H,33,38)(H,31,32,34)(H,29,30,35,41)/p+1 |
| InChIKey | BGQXQNREOMVWSI-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|