About 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane
1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane (PubChem CID 123582188) has the molecular formula C13H24
and a molecular weight of 180.34 g/mol. Its IUPAC name is 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane.
Molecular Properties
| Compound Name | 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane |
| PubChem CID | 123582188 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane |
| SMILES | CC(C)C(C)CCC12CCC1CC2 |
| InChI | InChI=1S/C13H24/c1-10(2)11(3)4-7-13-8-5-12(13)6-9-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | KRRWNWZSFGUTHA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane?
The IUPAC name of 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane (CID 123582188) is 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane.
What is the SMILES notation for 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane?
The canonical SMILES for 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane is CC(C)C(C)CCC12CCC1CC2.
What is the InChIKey of 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane?
The InChIKey is KRRWNWZSFGUTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-10(2)11(3)4-7-13-8-5-12(13)6-9-13/h10-12H,4-9H2,1-3H3.
What are the key properties of 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane?
1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane has a molecular weight of 180.34 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylpentyl)bicyclo[2.2.0]hexane is sourced from PubChem (CID 123582188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).