C7H11NS — CID 123582239
1,1-dimethyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene (PubChem CID 123582239) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 1,1-dimethyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene.
| Compound Name | 1,1-dimethyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 123582239 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 1,1-dimethyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene |
| SMILES | CS1(C)=CC=CC=NC=1 |
| InChI | InChI=1S/C7H11NS/c1-9(2)6-4-3-5-8-7-9/h3-7H,1-2H3 |
| InChIKey | AORHOJBEAJXXFC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|