C15H16N2O3S2 — CID 123582415
1,3-bis[(2-methoxyphenyl)sulfanyl]urea (PubChem CID 123582415) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1,3-bis[(2-methoxyphenyl)sulfanyl]urea.
| Compound Name | 1,3-bis[(2-methoxyphenyl)sulfanyl]urea |
|---|---|
| PubChem CID | 123582415 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1,3-bis[(2-methoxyphenyl)sulfanyl]urea |
| SMILES | COc1ccccc1SNC(=O)NSc1ccccc1OC |
| InChI | InChI=1S/C15H16N2O3S2/c1-19-11-7-3-5-9-13(11)21-16-15(18)17-22-14-10-6-4-8-12(14)20-2/h3-10H,1-2H3,(H2,16,17,18) |
| InChIKey | AGHRHXLCYRZOQY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|