C10H8O5S-2 — CID 19934779
2-(2-methoxyphenyl)sulfanylpropanedioate (PubChem CID 19934779) has the molecular formula C10H8O5S-2 and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)sulfanylpropanedioate.
| Compound Name | 2-(2-methoxyphenyl)sulfanylpropanedioate |
|---|---|
| PubChem CID | 19934779 |
| Molecular Formula | C10H8O5S-2 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-(2-methoxyphenyl)sulfanylpropanedioate |
| SMILES | COc1ccccc1SC(C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H10O5S/c1-15-6-4-2-3-5-7(6)16-8(9(11)12)10(13)14/h2-5,8H,1H3,(H,11,12)(H,13,14)/p-2 |
| InChIKey | BNOYRPYJHHKYKN-UHFFFAOYSA-L |
| XLogP | -1.34 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|