C36H70 — CID 123582467
1-(3-ethyl-4-methyldecyl)-2-(15,15,16-trimethylheptadec-5-en-2-yl)cyclopropane (PubChem CID 123582467) has the molecular formula C36H70 and a molecular weight of 502.96 g/mol. Its IUPAC name is 1-(3-ethyl-4-methyldecyl)-2-(15,15,16-trimethylheptadec-5-en-2-yl)cyclopropane.
| Compound Name | 1-(3-ethyl-4-methyldecyl)-2-(15,15,16-trimethylheptadec-5-en-2-yl)cyclopropane |
|---|---|
| PubChem CID | 123582467 |
| Molecular Formula | C36H70 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.55 |
| IUPAC Name | 1-(3-ethyl-4-methyldecyl)-2-(15,15,16-trimethylheptadec-5-en-2-yl)cyclopropane |
| SMILES | CCCCCCC(C)C(CC)CCC1CC1C(C)CCC=CCCCCCCCCC(C)(C)C(C)C |
| InChI | InChI=1S/C36H70/c1-9-11-12-21-24-31(5)33(10-2)26-27-34-29-35(34)32(6)25-22-19-17-15-13-14-16-18-20-23-28-36(7,8)30(3)4/h17,19,30-35H,9-16,18,20-29H2,1-8H3 |
| InChIKey | PBMAFLSKCNBBJM-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|