C19H22N2O — CID 123582838
1-cyclohexyl-2-(6-methyl-5H-imidazo[5,1-a]isoindol-5-yl)ethanone (PubChem CID 123582838) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-cyclohexyl-2-(6-methyl-5H-imidazo[5,1-a]isoindol-5-yl)ethanone.
| Compound Name | 1-cyclohexyl-2-(6-methyl-5H-imidazo[5,1-a]isoindol-5-yl)ethanone |
|---|---|
| PubChem CID | 123582838 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-cyclohexyl-2-(6-methyl-5H-imidazo[5,1-a]isoindol-5-yl)ethanone |
| SMILES | Cc1cccc2c1C(CC(=O)C1CCCCC1)n1cncc1-2 |
| InChI | InChI=1S/C19H22N2O/c1-13-6-5-9-15-17-11-20-12-21(17)16(19(13)15)10-18(22)14-7-3-2-4-8-14/h5-6,9,11-12,14,16H,2-4,7-8,10H2,1H3 |
| InChIKey | MQKDTOHXTGUILJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |