C17H20N4O — CID 121288670
N-cyclohexyl-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)acetamide (PubChem CID 121288670) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is N-cyclohexyl-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)acetamide |
|---|---|
| PubChem CID | 121288670 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-cyclohexyl-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)acetamide |
| SMILES | O=C(CC1c2ncccc2-c2cncn21)NC1CCCCC1 |
| InChI | InChI=1S/C17H20N4O/c22-16(20-12-5-2-1-3-6-12)9-14-17-13(7-4-8-19-17)15-10-18-11-21(14)15/h4,7-8,10-12,14H,1-3,5-6,9H2,(H,20,22) |
| InChIKey | AJIGRJDPNVBHPG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |