C23H35N3O2Si — CID 140706352
1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol (PubChem CID 140706352) has the molecular formula C23H35N3O2Si and a molecular weight of 413.64 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol |
|---|---|
| PubChem CID | 140706352 |
| Molecular Formula | C23H35N3O2Si |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaen-7-yl)ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(C(O)CC2c3ncccc3-c3cncn32)CC1 |
| InChI | InChI=1S/C23H35N3O2Si/c1-23(2,3)29(4,5)28-17-10-8-16(9-11-17)21(27)13-19-22-18(7-6-12-25-22)20-14-24-15-26(19)20/h6-7,12,14-17,19,21,27H,8-11,13H2,1-5H3 |
| InChIKey | UPNFAGQTAIUETE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|