C18H20N4O — CID 118857872
(NZ)-N-[1-cyclohexyl-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethylidene]nitrous amide (PubChem CID 118857872) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is (NZ)-N-[1-cyclohexyl-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethylidene]nitrous amide.
| Compound Name | (NZ)-N-[1-cyclohexyl-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethylidene]nitrous amide |
|---|---|
| PubChem CID | 118857872 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (NZ)-N-[1-cyclohexyl-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethylidene]nitrous amide |
| SMILES | O=N/N=C(/CC1c2ccccc2-c2cncn21)C1CCCCC1 |
| InChI | InChI=1S/C18H20N4O/c23-21-20-16(13-6-2-1-3-7-13)10-17-14-8-4-5-9-15(14)18-11-19-12-22(17)18/h4-5,8-9,11-13,17H,1-3,6-7,10H2/b20-16- |
| InChIKey | VSEJMENIYTTXGQ-SILNSSARSA-N |
| XLogP | 4.55 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|