About 5-cyclohexyl-5H-imidazo[5,1-a]isoindole
5-cyclohexyl-5H-imidazo[5,1-a]isoindole (PubChem CID 137374390) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 5-cyclohexyl-5H-imidazo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 5-cyclohexyl-5H-imidazo[5,1-a]isoindole |
| PubChem CID | 137374390 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 5-cyclohexyl-5H-imidazo[5,1-a]isoindole |
| SMILES | c1ccc2c(c1)-c1cncn1C2C1CCCCC1 |
| InChI | InChI=1S/C16H18N2/c1-2-6-12(7-3-1)16-14-9-5-4-8-13(14)15-10-17-11-18(15)16/h4-5,8-12,16H,1-3,6-7H2 |
| InChIKey | ZXUNUYPKRQCENX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexyl-5H-imidazo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-5H-imidazo[5,1-a]isoindole?
The IUPAC name of 5-cyclohexyl-5H-imidazo[5,1-a]isoindole (CID 137374390) is 5-cyclohexyl-5H-imidazo[5,1-a]isoindole.
What is the SMILES notation for 5-cyclohexyl-5H-imidazo[5,1-a]isoindole?
The canonical SMILES for 5-cyclohexyl-5H-imidazo[5,1-a]isoindole is c1ccc2c(c1)-c1cncn1C2C1CCCCC1.
What is the InChIKey of 5-cyclohexyl-5H-imidazo[5,1-a]isoindole?
The InChIKey is ZXUNUYPKRQCENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c1-2-6-12(7-3-1)16-14-9-5-4-8-13(14)15-10-17-11-18(15)16/h4-5,8-12,16H,1-3,6-7H2.
What are the key properties of 5-cyclohexyl-5H-imidazo[5,1-a]isoindole?
5-cyclohexyl-5H-imidazo[5,1-a]isoindole has a molecular weight of 238.33 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-5H-imidazo[5,1-a]isoindole is sourced from PubChem (CID 137374390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).