C15H16N2O2S — CID 137374425
4-(5H-imidazo[5,1-a]isoindol-5-yl)thiane 1,1-dioxide (PubChem CID 137374425) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(5H-imidazo[5,1-a]isoindol-5-yl)thiane 1,1-dioxide.
| Compound Name | 4-(5H-imidazo[5,1-a]isoindol-5-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 137374425 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(5H-imidazo[5,1-a]isoindol-5-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2c3ccccc3-c3cncn32)CC1 |
| InChI | InChI=1S/C15H16N2O2S/c18-20(19)7-5-11(6-8-20)15-13-4-2-1-3-12(13)14-9-16-10-17(14)15/h1-4,9-11,15H,5-8H2 |
| InChIKey | LIZWLPYELKWVML-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |