C15H16N2O — CID 137374520
5-(oxan-4-yl)-5H-imidazo[5,1-a]isoindole (PubChem CID 137374520) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-(oxan-4-yl)-5H-imidazo[5,1-a]isoindole.
| Compound Name | 5-(oxan-4-yl)-5H-imidazo[5,1-a]isoindole |
|---|---|
| PubChem CID | 137374520 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-(oxan-4-yl)-5H-imidazo[5,1-a]isoindole |
| SMILES | c1ccc2c(c1)-c1cncn1C2C1CCOCC1 |
| InChI | InChI=1S/C15H16N2O/c1-2-4-13-12(3-1)14-9-16-10-17(14)15(13)11-5-7-18-8-6-11/h1-4,9-11,15H,5-8H2 |
| InChIKey | PGXJWDPRFZCTAB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |