About 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide
4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide (PubChem CID 137374322) has the molecular formula C15H18N4O2S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide |
| PubChem CID | 137374322 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCC(C2c3ccccc3-c3cncn32)CC1 |
| InChI | InChI=1S/C15H18N4O2S/c16-22(20,21)18-7-5-11(6-8-18)15-13-4-2-1-3-12(13)14-9-17-10-19(14)15/h1-4,9-11,15H,5-8H2,(H2,16,20,21) |
| InChIKey | OXWAZOGAVXQWNB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide?
The IUPAC name of 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide (CID 137374322) is 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide.
What is the SMILES notation for 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide?
The canonical SMILES for 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide is NS(=O)(=O)N1CCC(C2c3ccccc3-c3cncn32)CC1.
What is the InChIKey of 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide?
The InChIKey is OXWAZOGAVXQWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2S/c16-22(20,21)18-7-5-11(6-8-18)15-13-4-2-1-3-12(13)14-9-17-10-19(14)15/h1-4,9-11,15H,5-8H2,(H2,16,20,21).
What are the key properties of 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide?
4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide has a molecular weight of 318.40 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-sulfonamide is sourced from PubChem (CID 137374322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).