About 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide
6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide (PubChem CID 137374428) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide.
Molecular Properties
| Compound Name | 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide |
| PubChem CID | 137374428 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide |
| SMILES | NS(=O)(=O)N1CC2(CC(C3c4ccccc4-c4cncn43)C2)C1 |
| InChI | InChI=1S/C16H18N4O2S/c17-23(21,22)19-8-16(9-19)5-11(6-16)15-13-4-2-1-3-12(13)14-7-18-10-20(14)15/h1-4,7,10-11,15H,5-6,8-9H2,(H2,17,21,22) |
| InChIKey | IRANVTLDYUXDDE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide?
The IUPAC name of 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide (CID 137374428) is 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide.
What is the SMILES notation for 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide?
The canonical SMILES for 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide is NS(=O)(=O)N1CC2(CC(C3c4ccccc4-c4cncn43)C2)C1.
What is the InChIKey of 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide?
The InChIKey is IRANVTLDYUXDDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2S/c17-23(21,22)19-8-16(9-19)5-11(6-16)15-13-4-2-1-3-12(13)14-7-18-10-20(14)15/h1-4,7,10-11,15H,5-6,8-9H2,(H2,17,21,22).
What are the key properties of 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide?
6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide has a molecular weight of 330.41 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-azaspiro[3.3]heptane-2-sulfonamide is sourced from PubChem (CID 137374428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).