C24H32N4O — CID 145351818
1,1-dicyclohexyl-3-[[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]methyl]urea (PubChem CID 145351818) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]methyl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 145351818 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 1,1-dicyclohexyl-3-[[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1c2ccccc2-c2cncn21)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H32N4O/c29-24(28(18-9-3-1-4-10-18)19-11-5-2-6-12-19)26-16-23-21-14-8-7-13-20(21)22-15-25-17-27(22)23/h7-8,13-15,17-19,23H,1-6,9-12,16H2,(H,26,29)/t23-/m0/s1 |
| InChIKey | UPLCFMPLPANAOL-QHCPKHFHSA-N |
| XLogP | 5.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |