C24H20N4O — CID 122504291
1-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)-3-(3-phenylphenyl)urea (PubChem CID 122504291) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)-3-(3-phenylphenyl)urea.
| Compound Name | 1-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)-3-(3-phenylphenyl)urea |
|---|---|
| PubChem CID | 122504291 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)-3-(3-phenylphenyl)urea |
| SMILES | O=C(NCC1c2ccccc2-c2cncn21)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H20N4O/c29-24(27-19-10-6-9-18(13-19)17-7-2-1-3-8-17)26-15-23-21-12-5-4-11-20(21)22-14-25-16-28(22)23/h1-14,16,23H,15H2,(H2,26,27,29) |
| InChIKey | JPQGXOMWUVEICO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |