C25H25N5O2 — CID 122504264
1-(4-cyano-2-cyclohexyloxyphenyl)-3-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)urea (PubChem CID 122504264) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-(4-cyano-2-cyclohexyloxyphenyl)-3-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)urea.
| Compound Name | 1-(4-cyano-2-cyclohexyloxyphenyl)-3-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 122504264 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-(4-cyano-2-cyclohexyloxyphenyl)-3-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)urea |
| SMILES | N#Cc1ccc(NC(=O)NCC2c3ccccc3-c3cncn32)c(OC2CCCCC2)c1 |
| InChI | InChI=1S/C25H25N5O2/c26-13-17-10-11-21(24(12-17)32-18-6-2-1-3-7-18)29-25(31)28-15-23-20-9-5-4-8-19(20)22-14-27-16-30(22)23/h4-5,8-12,14,16,18,23H,1-3,6-7,15H2,(H2,28,29,31) |
| InChIKey | KJVHNEGHBDDVRW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |