C21H21N5 — CID 145139926
4-[[1-(5H-imidazo[5,1-a]isoindol-5-ylmethylamino)ethylamino]methyl]benzonitrile (PubChem CID 145139926) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[[1-(5H-imidazo[5,1-a]isoindol-5-ylmethylamino)ethylamino]methyl]benzonitrile.
| Compound Name | 4-[[1-(5H-imidazo[5,1-a]isoindol-5-ylmethylamino)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 145139926 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 4-[[1-(5H-imidazo[5,1-a]isoindol-5-ylmethylamino)ethylamino]methyl]benzonitrile |
| SMILES | CC(NCc1ccc(C#N)cc1)NCC1c2ccccc2-c2cncn21 |
| InChI | InChI=1S/C21H21N5/c1-15(24-11-17-8-6-16(10-22)7-9-17)25-13-21-19-5-3-2-4-18(19)20-12-23-14-26(20)21/h2-9,12,14-15,21,24-25H,11,13H2,1H3 |
| InChIKey | FZZLVRUPUWWGPT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|